2,6-Pyridinedicarboxylic acid chloride
- Product Name2,6-Pyridinedicarboxylic acid chloride
- CAS3739-94-4
- CBNumberCB0722629
- MFC7H3Cl2NO2
- MW204.01
- EINECS223-125-4
- MDL NumberMFCD00006289
- MOL File3739-94-4.mol
Chemical Properties
| Melting point: | 56-58 °C (lit.) |
| Boiling point: | 284 °C (lit.) |
| Density | 1.4521 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| Flash point: | 284°C |
| storage temp. | Storage temp. 2-8°C |
| form | Crystalline Powder, Crystals or Chunks |
| pka | -2.12±0.10(Predicted) |
| color | White to brown |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 131556 |
| InChI | InChI=1S/C7H3Cl2NO2/c8-6(11)4-2-1-3-5(10-4)7(9)12/h1-3H |
| InChIKey | GWHOGODUVLQCEB-UHFFFAOYSA-N |
| SMILES | C1(C(Cl)=O)=NC(C(Cl)=O)=CC=C1 |
| CAS DataBase Reference | 3739-94-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Pyridinedicarbony chloride(3739-94-4) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H332-H317-H412 | |||||||||
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352-P304+P340+P312 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45-24/25 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-19-21 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2933399090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Skin Sens. 1A |
|||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|
