1,3-Bis(4-nitrophenyl)-urea-d8
- Product Name1,3-Bis(4-nitrophenyl)-urea-d8
- CAS1156508-87-0
- CBNumberCB0634788
- MFC13H10N4O5
- MW302.25
- MDL NumberMFCD06656252
- MOL FileMol file
Chemical Properties
| Melting point: | >300°C |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| color | Light Yellow to Yellow |
| Major Application | forensics and toxicology veterinary |
| InChI | InChI=1S/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18) |
| InChIKey | JEZZOKXIXNSKQD-UHFFFAOYSA-N |
| SMILES | N(C1C([H])=C([H])C(N(=O)=O)=C([H])C=1[H])C(=O)NC1C([H])=C([H])C(N(=O)=O)=C([H])C=1[H] |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |