Methyl 3-cyclopentenecarboxylate
- Product NameMethyl 3-cyclopentenecarboxylate
- CAS58101-60-3
- CBNumberCB0481577
- MFC7H10O2
- MW126.15
- MDL NumberMFCD04038661
- MOL File58101-60-3.mol
Chemical Properties
| Boiling point: | 74 °C(Press: 24 Torr) |
| Density | 1.031 g/mL at 25 °C |
| Flash point: | 48°(118°F) |
| refractive index | 1.4500 |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Colorless to pale brown |
| InChI | InChI=1S/C7H10O2/c1-9-7(8)6-4-2-3-5-6/h2-3,6H,4-5H2,1H3 |
| InChIKey | CEOILRYKIJRPBZ-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)CC=CC1 |
| CAS DataBase Reference | 58101-60-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-41 |
| Safety Statements | 24/25-36/39 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | 3 |
| HazardClass | 3 |
| HS Code | 2916200090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications |
Eye Dam. 1 Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
