3,5-Di-tert-butyl-4-hydroxybenzyl alcohol
- Product Name3,5-Di-tert-butyl-4-hydroxybenzyl alcohol
- CAS88-26-6
- CBNumberCB0282783
- MFC15H24O2
- MW236.35
- EINECS201-815-6
- MDL NumberMFCD00017254
- MOL File88-26-6.mol
Chemical Properties
| Melting point: | 139-141 °C(lit.) |
| Boiling point: | 214°C 40mm |
| Density | 0.9845 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.5542 (estimate) |
| Flash point: | 214°C/40mm |
| storage temp. | 2-8°C |
| Water Solubility | Insoluble in water |
| pka | 12.01±0.40(Predicted) |
| form | Solid:particulate/powder |
| color | White to Yellow to Orange |
| BRN | 2052291 |
| InChI | 1S/C15H24O2/c1-14(2,3)11-7-10(9-16)8-12(13(11)17)15(4,5)6/h7-8,16-17H,9H2,1-6H3 |
| InChIKey | HNURKXXMYARGAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CO)cc(c1O)C(C)(C)C |
| LogP | 3.16 at 20℃ |
| CAS DataBase Reference | 88-26-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Di-tert-butyl-4-hydroxybenzyl alcohol(88-26-6) |
| EPA Substance Registry System | 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenemethanol (88-26-6) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H412 | |||||||||
| Precautionary statements | P273-P501 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | DO0750000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2907299090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Aquatic Chronic 3 | |||||||||
| Toxicity | LDLo oral in mouse: 7gm/kg | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|