6-Methoxyflavone
- Product Name6-Methoxyflavone
- CAS26964-24-9
- CBNumberCB0200730
- MFC16H12O3
- MW252.26
- EINECS248-144-5
- MDL NumberMFCD00017322
- MOL File26964-24-9.mol
Chemical Properties
| Melting point: | 163-165 °C(lit.) |
| Boiling point: | 421.2±45.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C16H12O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | XZQLSABETMKIGG-UHFFFAOYSA-N |
| SMILES | COc1ccc2OC(=CC(=O)c2c1)c3ccccc3 |
| LogP | 3.470 (est) |
| CAS DataBase Reference | 26964-24-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | DJ3100438 | |||||||||
| HS Code | 2914.50.3000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|