| Boiling point |
66°C/0.3mmHg(lit.) |
| Density |
0.844±0.06 g/cm3(Predicted) |
| refractive index |
1.4190 to 1.4230 |
| solubility |
Practically insoluble in water, soluble in alcohol and oils. |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| Odor |
at 10.00 % in dipropylene glycol. aldehydic floral rose |
| Odor Type |
aldehydic |
| InChI |
InChI=1S/C13H28O2/c1-4-7-8-9-10-11-12-13(14-5-2)15-6-3/h13H,4-12H2,1-3H3 |
| InChIKey |
RJMSGTVQHHFVLK-UHFFFAOYSA-N |
| SMILES |
C(OCC)(OCC)CCCCCCCC |
| LogP |
4.588 (est) |
| EWG's Food Scores |
1 |
| NIST Chemistry Reference |
Nonane, 1,1-diethoxy-(54815-13-3) |
| EPA Substance Registry System |
Nonane, 1,1-diethoxy- (54815-13-3) |
