(+)-Diisopropyl L-tartrate
- Product Name(+)-Diisopropyl L-tartrate
- CAS2217-15-4
- CBNumberCB9714027
- MFC10H18O6
- MW234.25
- EINECS218-709-0
- MDL NumberMFCD00064450
- MOL File2217-15-4.mol
- MSDS FileSDS
Chemical Properties
| alpha | 17.25 º (neat) |
| Boiling point | 152 °C/12 mmHg (lit.) |
| Density | 1.114 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 229 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Viscous Liquid |
| pka | 11.70±0.20(Predicted) |
| color | Clear colorless |
| Specific Gravity | 1.121.114 |
| optical activity | [α]24/D +17°, neat |
| Sensitive | Hygroscopic |
| BRN | 1727863 |
| InChI | 1S/C10H18O6/c1-5(2)15-9(13)7(11)8(12)10(14)16-6(3)4/h5-8,11-12H,1-4H3/t7-,8-/m1/s1 |
| InChIKey | XEBCWEDRGPSHQH-HTQZYQBOSA-N |
| SMILES | CC(C)OC(=O)[C@H](O)[C@@H](O)C(=O)OC(C)C |
| CAS DataBase Reference | 2217-15-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H341 | |||||||||
| Precautionary statements | P501-P202-P201-P280-P308+P313-P405 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 24/25-36-26 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | WW8100000 | |||||||||
| HS Code | 29181300 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Toxicity | mouse,LD50,oral,6300uL/kg (6.3mL/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 93, Pg. 26, 1948. | |||||||||
| NFPA 704: |
|
