(-)-Menthyl chloroformate
- Product Name(-)-Menthyl chloroformate
- CAS14602-86-9
- CBNumberCB7248919
- MFC11H19ClO2
- MW218.72
- EINECS672-624-7
- MDL NumberMFCD00009694
- MOL File14602-86-9.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 108-109 °C11 mm Hg(lit.) |
| Density | 1.031 g/mL at 20 °C(lit.) |
| vapor pressure | 0.01 psi ( 20 °C) |
| refractive index | n |
| Flash point | 158 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| optical activity | [α]20/D 83°, c = 1 in chloroform |
| Sensitive | Moisture Sensitive |
| BRN | 2414686 |
| InChI | InChI=1S/C11H19ClO2/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | KIUPCUCGVCGPPA-KXUCPTDWSA-N |
| SMILES | C(Cl)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)=O |
| CAS DataBase Reference | 14602-86-9(CAS DataBase Reference) |
| UNSPSC Code | 12352101 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H331 | |||||||||
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P311-P305+P351+P338 | |||||||||
| Hazard Codes | T,N | |||||||||
| Risk Statements | 23-34-51/53 | |||||||||
| Safety Statements | 26-36/37/39-45-61 | |||||||||
| RIDADR | UN 3277 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-19-21 | |||||||||
| HS Code | 2915.90.5010 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | II | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 3 Inhalation Skin Corr. 1B | |||||||||
| NFPA 704: |
|
