| Melting point |
95-97°C |
| Boiling point |
504.3±50.0 °C(Predicted) |
| Density |
1.219±0.06 g/cm3(Predicted) |
| refractive index |
-22.6 ° (C=1, MeOH) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Soluble in dichloromethane |
| pka |
4.09±0.19(Predicted) |
| form |
Powder |
| color |
White to off-white |
| optical activity |
Consistent with structure |
| BRN |
2481680 |
| Major Application |
peptide synthesis |
| InChI |
1S/C16H21NO6/c1-16(2,3)23-15(21)17-12(9-13(18)19)14(20)22-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,17,21)(H,18,19)/t12-/m0/s1 |
| InChIKey |
LDRWTKQWSXGSTM-LBPRGKRZSA-N |
| SMILES |
CC(C)(C)OC(=O)N[C@@H](CC(O)=O)C(=O)OCc1ccccc1 |
| CAS DataBase Reference |
30925-18-9(CAS DataBase Reference) |
| UNSPSC Code |
12352209 |
| NACRES |
NA.22 |
