4-Acetylbenzenesulfonyl chloride
- Product Name4-Acetylbenzenesulfonyl chloride
- CAS1788-10-9
- CBNumberCB5355370
- MFC8H7ClO3S
- MW218.66
- MDL NumberMFCD00800269
- MOL File1788-10-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 84-87 °C |
| Boiling point | 338.6±25.0 °C(Predicted) |
| Density | 1.3949 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Sparingly), Methanol (Slightly) |
| form | Powder and/or Chunks |
| color | White to orange to brown |
| Water Solubility | Soluble in water (201.8 mg/L) 25°C. |
| Sensitive | Moisture Sensitive |
| BRN | 2099148 |
| InChI | 1S/C8H7ClO3S/c1-6(10)7-2-4-8(5-3-7)13(9,11)12/h2-5H,1H3 |
| InChIKey | FXVDNCRTKXMSEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(cc1)S(Cl)(=O)=O |
| CAS DataBase Reference | 1788-10-9(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34-36/37/38 | |||||||||
| Safety Statements | 26-36/37/39-45-25-36 | |||||||||
| RIDADR | UN 3261 8/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | No | |||||||||
| HazardClass | CORROSIVE | |||||||||
| HazardClass | 8 | |||||||||
| HS Code | 29147000 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| NFPA 704: |
|
