4-Nitrobenzaldoxime
- Product Name4-Nitrobenzaldoxime
- CAS1129-37-9
- CBNumberCB5195657
- MFC7H6N2O3
- MW166.13
- EINECS214-445-5
- MDL NumberMFCD00007377
- MOL File1129-37-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 126-130 °C (lit.) 128-131 °C |
| Boiling point | 294.32°C (rough estimate) |
| Density | 1.4334 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| storage temp. | Store at room temperature, keep dry and cool |
| pka | 9.97±0.10(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 973581 |
| InChI | 1S/C7H6N2O3/c10-8-5-6-1-3-7(4-2-6)9(11)12/h1-5,10H/b8-5+ |
| InChIKey | WTLPAVBACRIHHC-VMPITWQZSA-N |
| SMILES | [H]\C(=N\O)c1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 1129-37-9(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H315-H319-H335-H301 | |||||||||
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a-P301+P310 | |||||||||
| Hazard Codes | T,Xi | |||||||||
| Risk Statements | 25-36/37/38-20 | |||||||||
| Safety Statements | 36/37/39-45-26-22 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | CU7450000 | |||||||||
| Hazard Note | Toxic/Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29280000 | |||||||||
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral | |||||||||
| NFPA 704: |
|
