3,5-Difluorophenylacetic acid
- Product Name3,5-Difluorophenylacetic acid
- CAS105184-38-1
- CBNumberCB4381985
- MFC8H6F2O2
- MW172.13
- EINECS626-119-3
- MDL NumberMFCD00010316
- MOL File105184-38-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 68-70 °C (lit.) |
| Boiling point | 219°C (rough estimate) |
| Density | 1.3010 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.90±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 3605064 |
| InChI | InChI=1S/C8H6F2O2/c9-6-1-5(3-8(11)12)2-7(10)4-6/h1-2,4H,3H2,(H,11,12) |
| InChIKey | IGGNSAVLXJKCNH-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 105184-38-1(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-36/37/39-22-22/26/36/37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
