(R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine
- Product Name(R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine
- CAS23357-46-2
- CBNumberCB4378855
- MFC10H13N
- MW147.22
- EINECS628-771-4
- MDL NumberMFCD00671629
- MOL File23357-46-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 116-119 °C |
| Boiling point | 118-120 °C/10 mbar |
| Density | 1.002 g/mL at 25 °C |
| refractive index | 1.565 |
| Flash point | >110°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 9.39±0.20(Predicted) |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | Soluble in water (6.91g/L at 25°C). |
| Sensitive | Air Sensitive |
| BRN | 4231302 |
| InChI | InChI=1S/C10H13N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7,11H2/t10-/m1/s1 |
| InChIKey | JRZGPXSSNPTNMA-SNVBAGLBSA-N |
| SMILES | [C@H]1(N)C2=C(C=CC=C2)CCC1 |
| CAS DataBase Reference | 23357-46-2(CAS DataBase Reference) |
| FDA UNII | F59J0838WR |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H315-H319-H302-H314-H412-H335 | |||||||||
| Precautionary statements | P273-P280-P301+P312+P330-P303+P361+P353-P304+P340+P310-P305+P351+P338-P261-P280a-P304+P340-P405-P501a-P264-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | |||||||||
| Hazard Codes | Xi,N,C | |||||||||
| Risk Statements | 36/37-51/53-36/37/38-52/53-34-22 | |||||||||
| Safety Statements | 26-36/37/39-61-45 | |||||||||
| RIDADR | UN 3082 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 2921450090 | |||||||||
| NFPA 704: |
|
