(S)-4,5-Dihydro-2-(2-((S)-4,5-dihydro-4-isopropyloxazol-2-yl)propan-2-yl)-4-isopropyloxazole
- Product Name(S)-4,5-Dihydro-2-(2-((S)-4,5-dihydro-4-isopropyloxazol-2-yl)propan-2-yl)-4-isopropyloxazole
- CAS131833-92-6
- CBNumberCB4299329
- MFC15H26N2O2
- MW266.38
- MDL NumberMFCD08458310
- MOL FileMol file
- MSDS FileSDS
Chemical Properties
| Boiling point | 329.6±25.0 °C(Predicted) |
| Density | 0.9864 g/mL at 25 °C |
| refractive index | n20/D 1.4665 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 5.56±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| optical activity | [α]/D -121 to -113°, c = 1% in chloroform |
| InChI | 1S/C15H26N2O2/c1-9(2)11-7-18-13(16-11)15(5,6)14-17-12(8-19-14)10(3)4/h9-12H,7-8H2,1-6H3/t11-,12-/m1/s1 |
| InChIKey | XFZUPCITFHSROM-VXGBXAGGSA-N |
| SMILES | CC(C)[C@H]1COC(=N1)C(C)(C)C2=N[C@H](CO2)C(C)C |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H319 | |||||||||
| Precautionary statements | P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36 | |||||||||
| Safety Statements | 26 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2934.99.9001 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Eye Irrit. 2 | |||||||||
| NFPA 704: |
|
