2,6-Bis(di-t-butylphosphinomethyl)pyridine, 99%
- Product Name2,6-Bis(di-t-butylphosphinomethyl)pyridine, 99%
- CAS338800-13-8
- CBNumberCB41499443
- MFC23H43NP2
- MW395.54
- MDL NumberMFCD10565623
- MOL File338800-13-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 116-119°C |
| Boiling point | 456.3±45.0 °C(Predicted) |
| Flash point | 67℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 5.72±0.24(Predicted) |
| color | white to light-yellow |
| Sensitive | air sensitive |
| InChI | 1S/C23H43NP2/c1-20(2,3)25(21(4,5)6)16-18-14-13-15-19(24-18)17-26(22(7,8)9)23(10,11)12/h13-15H,16-17H2,1-12H3 |
| InChIKey | NJQAVBPPWNSBBC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(Cc1cccc(CP(C(C)(C)C)C(C)(C)C)n1)C(C)(C)C |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
| Signal word | Warning |
| Hazard statements | H261-H315-H319-H335 |
| Precautionary statements | P231+P232-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 14/15-36/37/38 |
| Safety Statements | 26-36/37/39-43 |
| RIDADR | UN 2813 4.3 / PGIII |
| WGK Germany | 3 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 Water-react 3 |