Cadmium 2,4-pentanedionate, hydrate
- Product NameCadmium 2,4-pentanedionate, hydrate
- CAS14689-45-3
- CBNumberCB2285177
- MFC10H14CdO4
- MW310.63
- EINECS238-730-9
- MDL NumberMFCD00040412
- MOL File14689-45-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 209-214 °C(lit.) |
| form | Powder |
| color | white |
| Water Solubility | Soluble in water 3.9 g/L. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 0.01 mg/m3; TWA 0.002 mg/m3 NIOSH: IDLH 9 mg/m3 |
| InChI | InChI=1S/2C5H8O2.Cd/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; |
| InChIKey | JXULEGTWCQDLTM-FDGPNNRMSA-L |
| SMILES | O([Cd]O/C(/C)=C\C(=O)C)/C(/C)=C\C(=O)C |
| REACH Annex XVII Substances List | Bis(pentane-2,4-dionato-O,O')cadmium (14689-45-3) |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H351-H361d-H373-H410 | |||||||||
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P304+P340+P312-P308+P313 | |||||||||
| Hazard Codes | Xn,N | |||||||||
| Risk Statements | 20/21/22-50/53 | |||||||||
| Safety Statements | 60-61 | |||||||||
| RIDADR | UN 2570 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | EV0260000 | |||||||||
| TSCA | No | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Repr. 2 STOT RE 2 | |||||||||
| NFPA 704: |
|
