N-Cbz-D-glutamic acid alpha-benzyl ester
- Product NameN-Cbz-D-glutamic acid alpha-benzyl ester
- CAS65706-99-2
- CBNumberCB1112654
- MFC20H21NO6
- MW371.38
- EINECS2017-001-1
- MDL NumberMFCD00069647
- MOL File65706-99-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 98.0 to 102.0 °C |
| Boiling point | 594.3±50.0 °C(Predicted) |
| Density | 1.268±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol and acetic acid. |
| form | Powder |
| pka | 4.47±0.10(Predicted) |
| color | White to off-white |
| BRN | 5305848 |
| Major Application | peptide synthesis |
| InChI | 1S/C20H21NO6/c22-18(23)12-11-17(19(24)26-13-15-7-3-1-4-8-15)21-20(25)27-14-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,21,25)(H,22,23)/t17-/m1/s1 |
| InChIKey | VWHKODOUMSMUAF-QGZVFWFLSA-N |
| SMILES | OC(=O)CC[C@@H](NC(=O)OCc1ccccc1)C(=O)OCc2ccccc2 |
| CAS DataBase Reference | 65706-99-2(CAS DataBase Reference) |
| UNSPSC Code | 12352200 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H311-H331-H341 | |||||||||
| Precautionary statements | P201-P202-P261-P264-P270-P271-P280-P302+P352-P304+P340-P308+P313-P310-P330-P361-P403+P233-P405-P501 | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 29242990 | |||||||||
| Storage Class | 13 - Non Combustible Solids | |||||||||
| NFPA 704: |
|
