Benzalkonium chloride
Bezeichnung:Benzalkonium chloride
CAS-Nr8001-54-5
Englisch Name:Benzalkonium chloride
CBNumberCB0712969
SummenformelC17H30ClN
Molgewicht283.88
MOL-Datei8001-54-5.mol
Benzalkonium chloride physikalisch-chemischer Eigenschaften
| Schmelzpunkt | -5°C |
| Siedepunkt | >100°C/760mmHg |
| chüttdichte | 800kg/m3 |
| Dichte | 0.98 |
| storage temp. | Store below +30°C. |
| Löslichkeit | Very soluble in water and in ethanol (96 per cent). An aqueous solution froths copiously when shaken. |
| Aggregatzustand | Viscous Solution |
| Wichte | 0.98 |
| Farbe | Clear or white to yellow, may contain yellow-white fragments |
| PH | 6-8 (20°C, 10g/L in H2O) |
| Stabilität | Stable. Incompatible with strong oxidizing agents, moisture. Hygroscopic. |
| InChI | InChI=1S/C10H16N.ClH/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KXHPPCXNWTUNSB-UHFFFAOYSA-M |
| SMILES | C1C=C(C[N+](C)(C)C)C=CC=1.[Cl-] |
| LogP | 1.692 (est) |
| CAS Datenbank | 8001-54-5(CAS DataBase Reference) |
| EPA chemische Informationen | Benzalkonium chloride (8001-54-5) |
| Kennzeichnung gefährlicher | C,N |
| R-Sätze: | 21/22-34-50 |
| S-Sätze: | 36/37/39-45-61 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| RTECS-Nr. | BO3151000 |
| F | 3-9 |
| HazardClass | 8 |
| HS Code | 34021200 |
| Speicherklasse | 8A - Combustible, corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 Skin Corr. 1B |
| Giftige Stoffe Daten | 8001-54-5(Hazardous Substances Data) |
| Toxizität | LD50 orally in rats: 400 mg/kg (Cummins, Kimura) |

