943757-71-9
| Name | Pyrrolidine, 2-[diphenyl[(trimethylsilyl)oxy]methyl]-, (2R)- |
| CAS | 943757-71-9 |
| Molecular Formula | C20H27NOSi |
| MDL Number | MFCD09265100 |
| Molecular Weight | 325.525 |
| MOL File | 943757-71-9.mol |
Chemical Properties
| Boiling point | 412.7±35.0 °C(Predicted) |
| density | 1.021 |
| refractive index | n20/D1.5509 |
| Fp | >110℃ |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | 10.01±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| Optical Rotation | [α]22/D +52±5°, c = 1 in chloroform |
| InChI | InChI=1S/C20H27NOSi/c1-23(2,3)22-20(19-15-10-16-21-19,17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,19,21H,10,15-16H2,1-3H3/t19-/m1/s1 |
| InChIKey | RSUHWMSTWSSNOW-LJQANCHMSA-N |
| SMILES | N1CCC[C@@H]1C(C1=CC=CC=C1)(C1=CC=CC=C1)O[Si](C)(C)C |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |