
92761-26-7
| Name | [(3E)-3-[[4-[(Z)-[7,7-dimethyl-3-oxo-4-(sulfomethyl)norbornan-2-yliden e]methyl]phenyl]methylidene]-7,7-dimethyl-2-oxo-norbornan-1-yl]methane sulfonic acid |
| CAS | 92761-26-7 |
| EINECS(EC#) | 410-960-6 |
| Molecular Formula | C28H34O8S2 |
| MDL Number | MFCD09838439 |
| Molecular Weight | 562.69 |
| MOL File | 92761-26-7.mol |
Chemical Properties
| Melting point | 255° (dec) |
| density | 1.424±0.06 g/cm3(Predicted) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 0.86±0.50(Predicted) |
| color | Light yellow to yellow |
| BRN | 8371688 |
| Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | LIGHT STABILIZER UV FILTER UV ABSORBER |
| InChIKey | IYNJWELIJKCWCX-DJOQCHOTSA-N |
| SMILES | C1(C=C2C3C(C)(C)C(CS(O)(=O)=O)(CC3)C2=O)=CC=C(C=C2C3C(C)(C)C(CS(O)(=O)=O)(CC3)C2=O)C=C1 |
Safety Data
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338+P310-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| REACH Registrations | Active |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |
| Hazardous Substances Data | 92761-26-7(Hazardous Substances Data) |
