92-35-3
| Name | THIOCHROME |
| CAS | 92-35-3 |
| EINECS(EC#) | 202-149-9 |
| Molecular Formula | C12H14N4OS |
| MDL Number | MFCD00010519 |
| Molecular Weight | 262.33 |
| MOL File | 92-35-3.mol |
Chemical Properties
| Melting point | 228.8°C |
| Boiling point | 462.6±55.0 °C(Predicted) |
| density | 1.2444 (rough estimate) |
| refractive index | 1.6440 (estimate) |
| storage temp. | Store at -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | neat |
| pka | 14?+-.0.10(Predicted) |
| color | Light yellow to yellow |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C12H14N4OS/c1-7-10(3-4-17)18-12-15-11-9(6-16(7)12)5-13-8(2)14-11/h5,17H,3-4,6H2,1-2H3 |
| InChIKey | GTQXMAIXVFLYKF-UHFFFAOYSA-N |
| SMILES | Cc1ncc2CN3C(C)=C(CCO)SC3=Nc2n1 |
| EPA Substance Registry System | 5H-Pyrimido[4,5-d]thiazolo[3,2-a]pyrimidine-8-ethanol, 2,7-dimethyl- (92-35-3) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |