9006-26-2
| Name | POLY(ETHYLENE-ALT-MALEIC ANHYDRIDE) |
| CAS | 9006-26-2 |
| EINECS(EC#) | 249-596-6 |
| Molecular Formula | C18H18O9X2 |
| MDL Number | MFCD00134015 |
| Molecular Weight | 378.33 |
| MOL File | 9006-26-2.mol |
Chemical Properties
| Appearance | Fine, water-soluble powder available as both straight-chain and cross-linked polymers in a variety of molecular weights. May be in form of free acid, sodium, or amide-ammonium salts. Reacts readily with alcohols and amines. |
| Melting point | >400 °C |
| density | 0.92g/mLat 25℃ |
| solubility | : Neutralization increases water solubility.soluble |
| form | powder |
| Water Solubility | H2O: insoluble toluene and xylene: soluble |
| Cosmetics Ingredients Functions | FILM FORMING BINDING |
| InChI | InChI=1S/C4H2O3.C2H4/c5-3-1-2-4(6)7-3;1-2/h1-2H;1-2H2 |
| InChIKey | YYXLGGIKSIZHSF-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(O1)=O.C=C |
| EPA Substance Registry System | Maleic anhydride ethene polymer (9006-26-2) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | LU1400000 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Toxicity |