82-86-0
| Name | Acenaphthenequinone |
| CAS | 82-86-0 |
| EINECS(EC#) | 201-441-3 |
| Molecular Formula | C12H6O2 |
| MDL Number | MFCD00003805 |
| Molecular Weight | 182.17 |
| MOL File | 82-86-0.mol |
Chemical Properties
| Appearance | ochre powder and granules |
| Melting point | 249-252 °C (dec.) (lit.) |
| Boiling point | 67 C |
| density | 1.4800 |
| refractive index | 1.6086 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform |
| form | Powder and Granules |
| color | Ochre |
| Water Solubility | INSOLUBLE |
| BRN | 879172 |
| InChI | InChI=1S/C12H6O2/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)14/h1-6H |
| InChIKey | AFPRJLBZLPBTPZ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2C3C(C=CC=2)=CC=CC=3C1=O |
| CAS DataBase Reference | 82-86-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Acenaphthylenedione(82-86-0) |
| EPA Substance Registry System | 82-86-0(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2920 |
| WGK Germany | 3 |
| RTECS | AB1024500 |
| TSCA | Yes |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 82-86-0(Hazardous Substances Data) |
| Toxicity |