74568-07-3
| Name | Calix[4]arene |
| CAS | 74568-07-3 |
| Molecular Formula | C28H24O4 |
| MDL Number | MFCD00143912 |
| Molecular Weight | 424.494 |
| MOL File | 74568-07-3.mol |
Chemical Properties
| Appearance | off-white to light beige crystalline powder |
| Melting point | 310-314 °C |
| Boiling point | 500.52°C (rough estimate) |
| density | 1.1077 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | Soluble in chloroform. |
| form | Crystalline Powder |
| pka | 9.38±0.20(Predicted) |
| color | Off-white to light beige |
| BRN | 3574428 |
| InChI | InChI=1S/C28H24O4/c29-25-17-5-1-6-18(25)14-20-8-3-10-22(27(20)31)16-24-12-4-11-23(28(24)32)15-21-9-2-7-19(13-17)26(21)30/h1-12,29-32H,13-16H2 |
| InChIKey | YPNHVQZZPXPQOS-UHFFFAOYSA-N |
| SMILES | C12=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)C2 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |