705-09-9
| Name | 2-Difluoromethyl-1H-benzoimidazole |
| CAS | 705-09-9 |
| Molecular Formula | C8H6F2N2 |
| MDL Number | MFCD00463015 |
| Molecular Weight | 168.14 |
| MOL File | 705-09-9.mol |
Chemical Properties
| Melting point | 155.0 to 159.0 °C |
| Boiling point | 57-62 °C(Press: 5 Torr) |
| density | 1.366±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 10.43±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| λmax | 276nm(EtOH)(lit.) |
| InChI | InChI=1S/C8H6F2N2/c9-7(10)8-11-5-3-1-2-4-6(5)12-8/h1-4,7H,(H,11,12) |
| InChIKey | PURNIHSRWGYONZ-UHFFFAOYSA-N |
| SMILES | C1(C(F)F)NC2=CC=CC=C2N=1 |
