69980-24-1
| Name | (+/-)-NICOTINE-METHYL-D3 |
| CAS | 69980-24-1 |
| Molecular Formula | C10H11D3N2 |
| MDL Number | MFCD00190489 |
| Molecular Weight | 165.25 |
| MOL File | 69980-24-1.mol |
Chemical Properties
| Appearance | Clear Colourless Oil |
| Boiling point | 247 °C745 mm Hg(lit.) |
| density | 1.029 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 215 °F |
| storage temp. | Refrigerator |
| solubility | DMF: 50 mg/ml,DMSO: 30 mg/ml,Ethanol: 50 mg/ml,PBS (pH 7.2): 1 mg/ml |
| form | Oil |
| color | Colourless to Yellow |
| Stability: | May Turn Brown on Exposure to Light or Air |
| Major Application | environmental |
| InChI | 1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/i1D3 |
| InChIKey | SNICXCGAKADSCV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCCC1c2cccnc2 |
| CAS Number Unlabeled | 22083-74-5 |
Safety Data
| Hazard Codes | T+,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1654 6.1/PG 2 |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 |