672-30-0
| Name | 1-BROMO-3-(PENTAFLUOROSULFANYL)BENZENE |
| CAS | 672-30-0 |
| Molecular Formula | C6H4BrF5S |
| MDL Number | MFCD03425927 |
| Molecular Weight | 283.06 |
| MOL File | 672-30-0.mol |
Chemical Properties
| Boiling point | 82 °C(Press: 12 Torr) |
| density | 1.831 g/mL at 25 °C |
| refractive index | n20/D 1.480 |
| Fp | 88 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Red |
| InChI | InChI=1S/C6H4BrF5S/c7-5-2-1-3-6(4-5)13(8,9,10,11)12/h1-4H |
| InChIKey | QRPMKEUTGAXKSD-UHFFFAOYSA-N |
| SMILES | C1(S(F)(F)(F)(F)F)=CC=CC(Br)=C1 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P261-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |