636-28-2
| Name | 1,2,4,5-TETRABROMOBENZENE |
| CAS | 636-28-2 |
| EINECS(EC#) | 211-253-3 |
| Molecular Formula | C6H2Br4 |
| MDL Number | MFCD00000063 |
| Molecular Weight | 393.7 |
| MOL File | 636-28-2.mol |
Chemical Properties
| Appearance | brown crystalline needles |
| Melting point | 180-182 °C (lit.) |
| Boiling point | 277.95°C (rough estimate) |
| density | 3,072 g/cm3 |
| refractive index | 1.6303 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in alcohol, benzene, and ether (Weast, 1986) |
| form | Crystalline Powder, Crystals or Needles |
| color | Beige to brown |
| Water Solubility | Insoluble in water. |
| BRN | 1365830 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C6H2Br4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H |
| InChIKey | QCKHVNQHBOGZER-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(Br)=C(Br)C=C1Br |
| CAS DataBase Reference | 636-28-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2,4,5-Tetrabromobenzene (636-28-2) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |