6359-05-3
| Name | ETHYL EOSIN |
| CAS | 6359-05-3 |
| EINECS(EC#) | 228-793-0 |
| Molecular Formula | C22H11Br4KO5 |
| MDL Number | MFCD00005039 |
| Molecular Weight | 714.03 |
| MOL File | 6359-05-3.mol |
Chemical Properties
| Appearance | red to brown powder |
| Melting point | >200℃ |
| storage temp. | room temp |
| solubility | Soluble in hot water; slightly soluble in ethanol |
| Colour Index | 45386 |
| form | crystals or powder |
| color | Red-brown |
| Water Solubility | Freely soluble |
| λmax | 532 nm |
| Biological Applications | Drug delivery and tissue engineering; photodynamic therapy; dental materials; treating cancer,diabetes; wound dressing materials |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C22H12Br4O5.K/c1-2-30-22(29)10-6-4-3-5-9(10)15-11-7-13(23)18(27)16(25)20(11)31-21-12(15)8-14(24)19(28)17(21)26;/h3-8,27H,2H2,1H3;/q;+1/p-1 |
| InChIKey | UKZQEOHHLOYJLY-UHFFFAOYSA-M |
| SMILES | [K+].CCOC(=O)c1ccccc1C2=C3C=C(Br)C(=O)C(Br)=C3Oc4c(Br)c([O-])c(Br)cc24 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 32041900 |
| Storage Class | 11 - Combustible Solids |