
62996-74-1
| Name | STAUROSPORINE |
| CAS | 62996-74-1 |
| EINECS(EC#) | 999-999-2 |
| Molecular Formula | C28H26N4O3 |
| MDL Number | MFCD00077402 |
| Molecular Weight | 466.53 |
| MOL File | 62996-74-1.mol |
Chemical Properties
| Appearance | Light Yellow Solid |
| Occurrence | A complex alkaloid. staurosporine has been isolated from a strain of Streptomyces. |
| Melting point | 270°C |
| alpha | D25 +35.0° (c = 1 in methanol); D22 +56.1° (c = 0.14 in methanol) |
| Boiling point | 677.5±55.0 °C(Predicted) |
| density | 1.56±0.1 g/cm3(Predicted) |
| RTECS | KD5084000 |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble |
| form | White to pale yellow solid |
| pka | 14.25±0.70(Predicted) |
| color | Off white to pale yellow |
| Water Solubility | Soluble in DMSO or ethanol.Soluble in dimethyl sulfoxide , dimethyl formamide, ethyl acetate, hot acetone and ethanol. Slightly soluble in chloroform and methanol. Insoluble in water. |
| BRN | 1060573 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 4 months. |
| InChIKey | HKSZLNNOFSGOKW-WIFUGMKFSA-N |
| SMILES | CN[C@@H]1C[C@@H]2O[C@@](C)([C@@H]1OC)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 |
| CAS DataBase Reference | 62996-74-1 |
Safety Data
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361d-H413 |
| Precautionary statements | P201-P202-P273-P280-P308+P313-P405 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | 2 |
| F | 8-10 |
| HazardClass | 3 |
| HS Code | 29419090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 4 Carc. 1B Muta. 1B Repr. 2 |
