626-15-3
| Name | 1,3-Bis(bromomethyl)benzene |
| CAS | 626-15-3 |
| EINECS(EC#) | 210-931-6 |
| Molecular Formula | C8H8Br2 |
| MDL Number | MFCD00000178 |
| Molecular Weight | 263.96 |
| MOL File | 626-15-3.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 74-77 °C(lit.) |
| Boiling point | 135-140 °C20 mm Hg(lit.) |
| density | 1.9590 |
| refractive index | 1.6113 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | dioxane: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder and Chunks |
| color | White to brown |
| Water Solubility | Insoluble in water. |
| BRN | 971085 |
| InChI | InChI=1S/C8H8Br2/c9-5-7-2-1-3-8(4-7)6-10/h1-4H,5-6H2 |
| InChIKey | OXHOPZLBSSTTBU-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC(CBr)=C1 |
| CAS DataBase Reference | 626-15-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3-bis(bromomethyl)-(626-15-3) |
| EPA Substance Registry System | 626-15-3(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3448 6.1/PG 2 |
| WGK Germany | 3 |
| F | 8-19-21 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |