62-51-1
| Name | METHACHOLINE CHLORIDE |
| CAS | 62-51-1 |
| EINECS(EC#) | 200-537-2 |
| Molecular Formula | C8H18ClNO2 |
| MDL Number | MFCD00011817 |
| Molecular Weight | 195.69 |
| MOL File | 62-51-1.mol |
Chemical Properties
| Appearance | colourless to white crystalline powder with a slight |
| Melting point | 171-173 °C(lit.) |
| density | 1.1028 (rough estimate) |
| refractive index | 1.5790 (estimate) |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | powder |
| color | White to Almost white |
| PH | 3.0～7.0 (50g/l, 25℃) |
| Stability: | Unstable-moisture sensitive. Incompatible with oxidizing agents. |
| Water Solubility | almost transparency |
| Merck | 14,5940 |
| BRN | 4162373 |
| InChI | 1S/C8H18NO2.ClH/c1-7(11-8(2)10)6-9(3,4)5;/h7H,6H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | JHPHVAVFUYTVCL-UHFFFAOYSA-M |
| SMILES | [Cl-].CC(C[N+](C)(C)C)OC(C)=O |
| LogP | -3.957 (est) |
| CAS DataBase Reference | 62-51-1 |
| EPA Substance Registry System | 1-Propanaminium, 2-(acetyloxy)-N,N,N-trimethyl-, chloride (62-51-1) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | BR5250000 |
| F | 3-10-21 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |