618-87-1
| Name | 3,5-DINITROANILINE |
| CAS | 618-87-1 |
| EINECS(EC#) | 210-567-8 |
| Molecular Formula | C6H5N3O4 |
| MDL Number | MFCD00007263 |
| Molecular Weight | 183.12 |
| MOL File | 618-87-1.mol |
Chemical Properties
| Appearance | yellow to brownish yellow powder |
| Melting point | 160-162 °C(lit.) |
| Boiling point | 316.77°C (rough estimate) |
| density | 1.6010 |
| refractive index | 1.6910 (estimate) |
| storage temp. | room temp |
| Water Solubility | Practically insoluble in water |
| form | Powder |
| pka | pK1:0.229(+1) (25°C) |
| color | Yellow to brownish yellow |
| BRN | 648811 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C6H5N3O4/c7-4-1-5(8(10)11)3-6(2-4)9(12)13/h1-3H,7H2 |
| InChIKey | MPBZUKLDHPOCLS-UHFFFAOYSA-N |
| SMILES | Nc1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 618-87-1(CAS DataBase Reference) |
| EPA Substance Registry System | 3,5-Dinitroaniline (618-87-1) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1596 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | BX9200100 |
| F | 8 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29214200 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 1 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |