617-62-9
| Name | 2-METHYLGLUTARIC ACID |
| CAS | 617-62-9 |
| EINECS(EC#) | 210-521-7 |
| Molecular Formula | C6H10O4 |
| MDL Number | MFCD00002661 |
| Molecular Weight | 146.14 |
| MOL File | 617-62-9.mol |
Chemical Properties
| Melting point | 80-82 °C(lit.) |
| Boiling point | 214-215 °C22 mm Hg(lit.) |
| density | 1.246 |
| vapor pressure | 0.001Pa at 20℃ |
| Fp | 149℃ |
| storage temp. | Store below +30°C. |
| solubility | DMF: 20 mg/ml; DMSO: 16 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 10 mg/ml |
| form | powder to crystal |
| pka | 4.57±0.10(Predicted) |
| color | White to Light yellow |
| PH | 2.8 (10g/L in H2O) |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C6H10O4/c1-4(6(9)10)2-3-5(7)8/h4H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | AQYCMVICBNBXNA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(C)CCC(O)=O |
| LogP | -1.3 at 20℃ |
| EPA Substance Registry System | 2-Methylglutaric acid (617-62-9) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H412 |
| Precautionary statements | P260-P273-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HS Code | 2917198090 |
| Storage Class | 8A - Combustible, corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B |