583-93-7
| Name | 2,6-DIAMINOPIMELIC ACID |
| CAS | 583-93-7 |
| EINECS(EC#) | 209-524-6 |
| Molecular Formula | C7H14N2O4 |
| MDL Number | MFCD00002637 |
| Molecular Weight | 190.2 |
| MOL File | 583-93-7.mol |
Chemical Properties
| Appearance | white to beige powder and/or chunks |
| Melting point | ~295 °C (dec.) (lit.) |
| Boiling point | 325.69°C (rough estimate) |
| density | 1.2963 (rough estimate) |
| refractive index | 1.4331 (estimate) |
| storage temp. | Store at RT. |
| solubility | Water (Slightly, Heated) |
| form | Powder and/or Chunks |
| pka | 2.20±0.24(Predicted) |
| color | White to beige |
| Water Solubility | Soluble in water, diluted acids and alkali. |
| BRN | 1787719 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
| InChIKey | GMKMEZVLHJARHF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(N)CCCC(N)C(O)=O |
| CAS DataBase Reference | 583-93-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |