5565-32-2
| Name | CHLOROTRIS(TRIMETHYLSILYL)SILANE |
| CAS | 5565-32-2 |
| Molecular Formula | C9H27ClSi4 |
| MDL Number | MFCD01321222 |
| Molecular Weight | 283.11 |
| MOL File | 5565-32-2.mol |
Chemical Properties
| Melting point | 50-52 °C(lit.) |
| Boiling point | 93°C/1.8mmHg(lit.) |
| density | 0.877 g/mL at 25 °C |
| Fp | 87 °F |
| form | powder to lump |
| color | White to Almost white |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | 1S/C9H27ClSi4/c1-11(2,3)14(10,12(4,5)6)13(7,8)9/h1-9H3 |
| InChIKey | HCOROOJWVHFMRJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si](Cl)([Si](C)(C)C)[Si](C)(C)C |
Safety Data
| Hazard Codes | F,C,Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2925 4.1/PG 2 |
| WGK Germany | 3 |
| HS Code | 2931.90.9010 |
| HazardClass | 4.1/8 |
| PackingGroup | II |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 Water-react 3 |