532-18-3
| Name | 2,2-Dinaphthylamine |
| CAS | 532-18-3 |
| EINECS(EC#) | 208-529-0 |
| Molecular Formula | C20H15N |
| MDL Number | MFCD03093264 |
| Molecular Weight | 269.34 |
| MOL File | 532-18-3.mol |
Chemical Properties
| Melting point | 174 °C |
| Boiling point | 471 °C |
| density | 0.9788 (rough estimate) |
| refractive index | 1.7800 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | very slightly in Ethanol |
| form | powder to crystal |
| color | White to Orange to Green |
| Merck | 14,3267 |
| InChI | InChI=1S/C20H15N/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14,21H |
| InChIKey | SBMXAWJSNIAHFR-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1NC1=CC=C2C(=C1)C=CC=C2 |
| NIST Chemistry Reference | 2-Naphthalenamine, N-2-naphthalenyl-(532-18-3) |
Safety Data
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2921.49.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |