51751-44-1
| Name | 3,3'-Dibromo-2,2'-bithiophene |
| CAS | 51751-44-1 |
| EINECS(EC#) | 663-413-0 |
| Molecular Formula | C8H4Br2S2 |
| MDL Number | MFCD00114806 |
| Molecular Weight | 324.05 |
| MOL File | 51751-44-1.mol |
Chemical Properties
| Melting point | 103°C |
| Boiling point | 318.6±37.0 °C(Predicted) |
| density | 1.951±0.06 g/cm3(Predicted) |
| storage temp. | 0-10°C |
| solubility | soluble in Toluene |
| form | powder |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C8H4Br2S2/c9-5-1-3-11-7(5)8-6(10)2-4-12-8/h1-4H |
| InChIKey | KBRZCEVRNLKHAZ-UHFFFAOYSA-N |
| SMILES | C1(C2SC=CC=2Br)SC=CC=1Br |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310+P330-P305+P351+P338+P310 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
