513-00-8
| Name | ISO-OMPA |
| CAS | 513-00-8 |
| EINECS(EC#) | 208-149-5 |
| Molecular Formula | C12H32N4O3P2 |
| MDL Number | MFCD00048272 |
| Molecular Weight | 342.36 |
| MOL File | 513-00-8.mol |
Chemical Properties
| Melting point | 151 °C(Solv: acetone (67-64-1)) |
| Boiling point | 396.7±25.0 °C(Predicted) |
| density | 1.076±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| form | Solid |
| pka | 1.22±0.70(Predicted) |
| color | White to off-white |
| biological source | synthetic |
| InChI | 1S/C12H32N4O3P2/c1-9(2)13-20(17,14-10(3)4)19-21(18,15-11(5)6)16-12(7)8/h9-12H,1-8H3,(H2,13,14,17)(H2,15,16,18) |
| InChIKey | IOIMDJXKIMCMIG-UHFFFAOYSA-N |
| SMILES | CC(C)NP(=O)(NC(C)C)OP(=O)(NC(C)C)NC(C)C |
| EPA Substance Registry System | Diphosphoramide, N,N',N'',N'''-tetrakis(1-methylethyl)- (513-00-8) |
Safety Data
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral |