
51094-17-8
| Name | 5,10,15,20-TETRAKIS(4-HYDROXYPHENYL)-21H,23H-PORPHINE |
| CAS | 51094-17-8 |
| Molecular Formula | C44H30N4O4 |
| MDL Number | MFCD00191501 |
| Molecular Weight | 678.73 |
| MOL File | 51094-17-8.mol |
Chemical Properties
| Melting point | >300 °C(lit.) |
| density | 1.401±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| form | powder to crystal |
| color | Gray to Dark purple to Black |
| ε(extinction coefficient) | ≥285000 at 417-423nm in methanol at 0.001g/L |
| λmax | 421 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | VFHDWGAEEDVVPD-LWQDQPMZSA-N |
| SMILES | C1(C2=CC=C(O)C=C2)=C2N=C(C(C3=CC=C(O)C=C3)=C3NC(=C(C4=CC=C(O)C=C4)C4=NC(=C(C5=CC=C(O)C=C5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:20,t:8,23,35| |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3263 8/PG 3 |
| WGK Germany | 1 |
| HS Code | 2934.30.5000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1A STOT SE 3 |

