
487-36-5
| Name | (+)-PINORESINOL |
| CAS | 487-36-5 |
| Molecular Formula | C20H22O6 |
| MDL Number | MFCD07784516 |
| Molecular Weight | 358.39 |
| MOL File | 487-36-5.mol |
Chemical Properties
| Melting point | 112 °C |
| Boiling point | 556.5±50.0 °C(Predicted) |
| density | 1.385 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: ≥6mg/mL |
| form | Solid |
| pka | 9.54±0.35(Predicted) |
| color | white to tan |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20+/m0/s1 |
| InChIKey | HGXBRUKMWQGOIE-AFHBHXEDSA-N |
| SMILES | O1C[C@]2([H])[C@@H](C3=CC=C(O)C(OC)=C3)OC[C@]2([H])[C@H]1C1=CC=C(O)C(OC)=C1 |
| LogP | 1.591 (est) |