
4415-87-6
| Name | Cyclobutane-1,2,3,4-tetracarboxylic dianhydride |
| CAS | 4415-87-6 |
| EINECS(EC#) | 224-577-5 |
| Molecular Formula | C8H4O6 |
| MDL Number | MFCD00004944 |
| Molecular Weight | 196.11 |
| MOL File | 4415-87-6.mol |
Chemical Properties
| Melting point | >300 °C (lit.) |
| Boiling point | 545.3±50.0 °C(Predicted) |
| density | 1.823±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1430553 |
| InChI | InChI=1S/C8H4O6/c9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12/h1-4H |
| InChIKey | YGYCECQIOXZODZ-UHFFFAOYSA-N |
| SMILES | O1C(=O)C2C3C(C2C1=O)C(=O)OC3=O |
| CAS DataBase Reference | 4415-87-6(CAS DataBase Reference) |
| Storage Precautions | Store under inert gas;Moisture sensitive |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1759 |
| WGK Germany | 3 |
| F | 9-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29172090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

