42573-57-9
| Name | 2,4-Bis(trichloromethyl)-6-(4-methoxystyryl)-1,3,5-triazine |
| CAS | 42573-57-9 |
| EINECS(EC#) | 255-893-1 |
| Molecular Formula | C14H9Cl6N3O |
| MDL Number | MFCD01940892 |
| Molecular Weight | 447.96 |
| MOL File | 42573-57-9.mol |
Chemical Properties
| Melting point | 192-195 °C(lit.) |
| Boiling point | 511.4±60.0 °C(Predicted) |
| density | 1.605 |
| form | powder to crystal |
| pka | -1.88±0.10(Predicted) |
| color | Light yellow to Amber to Dark green |
| λmax | 379 nm |
| InChI | InChI=1S/C14H9Cl6N3O/c1-24-9-5-2-8(3-6-9)4-7-10-21-11(13(15,16)17)23-12(22-10)14(18,19)20/h2-7H,1H3 |
| InChIKey | MCNPOZMLKGDJGP-UHFFFAOYSA-N |
| SMILES | N1=C(C(Cl)(Cl)Cl)N=C(C(Cl)(Cl)Cl)N=C1C=CC1=CC=C(OC)C=C1 |
| EPA Substance Registry System | 1,3,5-Triazine, 2-[2-(4-methoxyphenyl)ethenyl]- 4,6-bis(trichloromethyl)- (42573-57-9) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29336990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |