
409071-16-5
| Name | Lithium difluoro(oxalato)borate(1-) |
| CAS | 409071-16-5 |
| EINECS(EC#) | 803-919-2 |
| Molecular Formula | C2BF2O4.Li |
| MDL Number | MFCD21608640 |
| Molecular Weight | 143.76 |
| MOL File | 409071-16-5.mol |
Chemical Properties
| Melting point | 265-271°C |
| Boiling point | 275.3℃ at 102kPa |
| density | 2.01-2.065g/cm3 at 20℃ |
| vapor pressure | 0.003Pa at 20℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Water (Slightly) |
| form | powder |
| color | White to Off-White |
| Major Application | battery manufacturing |
| InChI | InChI=1S/C2BF2O4.Li/c4-3(5)8-1(6)2(7)9-3;/q-1;+1 |
| InChIKey | MEDDCIKGDMDORY-UHFFFAOYSA-N |
| SMILES | [F-][B+3]1([O-]C(=O)C(=O)[O-]1)[F-].[Li+] |
| LogP | -1.18--1.1 at 25℃ and pH2-8 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
