
401-95-6
| Name | 3,5-Bis(trifluoromethyl)benzaldehyde |
| CAS | 401-95-6 |
| EINECS(EC#) | 202-860-4 |
| Molecular Formula | C9H4F6O |
| MDL Number | MFCD00010206 |
| Molecular Weight | 242.12 |
| MOL File | 401-95-6.mol |
Chemical Properties
| Appearance | clear colorless to yellow liquid |
| Boiling point | 37 °C1.3 mm Hg(lit.) |
| density | 1.469 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 158 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.469 |
| Water Solubility | Insoluble in water. Soluble in many organic solvents. |
| Sensitive | Air Sensitive |
| BRN | 1884058 |
| InChI | InChI=1S/C9H4F6O/c10-8(11,12)6-1-5(4-16)2-7(3-6)9(13,14)15/h1-4H |
| InChIKey | LDWLIXZSDPXYDR-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 401-95-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzaldehyde(401-95-6) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29124990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
