38861-78-8
| Name | 4'-(2-Methylpropyl)acetophenone |
| CAS | 38861-78-8 |
| EINECS(EC#) | 254-159-8 |
| Molecular Formula | C12H16O |
| MDL Number | MFCD00027393 |
| Molecular Weight | 176.25 |
| MOL File | 38861-78-8.mol |
Chemical Properties
| Boiling point | 134-135°C 16mm |
| density | 0,952 g/cm3 |
| vapor pressure | 0.75Pa at 20℃ |
| refractive index | 1.5180 |
| Fp | 54°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Dichloromethane; Diethyl Ether; Ethyl Acetate; THF |
| form | neat |
| color | Colorless to Yellow |
| Water Solubility | Miscible with chloroform and methanol. Slightly miscible with water. |
| BRN | 1935275 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C12H16O/c1-9(2)8-11-4-6-12(7-5-11)10(3)13/h4-7,9H,8H2,1-3H3 |
| InChIKey | KEAGRYYGYWZVPC-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(CC(C)C)C=C1)C |
| LogP | 3.4 at 23℃ |
| CAS DataBase Reference | 38861-78-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4'-(2-Methylpropyl)acetophenone(38861-78-8) |
| EPA Substance Registry System | 38861-78-8(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H411 |
| Precautionary statements | P261-P264-P272-P273-P280-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1224 |
| WGK Germany | 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29143990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Irrit. 2 Skin Sens. 1B |
