36011-19-5
| Name | CYTOCHALASIN E |
| CAS | 36011-19-5 |
| EINECS(EC#) | 252-835-7 |
| Molecular Formula | C28H33NO7 |
| MDL Number | MFCD00005178 |
| Molecular Weight | 495.56 |
| MOL File | 36011-19-5.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | 206 °C |
| Boiling point | 587.59°C (rough estimate) |
| density | 1.2415 (rough estimate) |
| refractive index | 1.6290 (estimate) |
| storage temp. | −20°C |
| solubility | DMF: 11 mg/ml; DMF:PBS (pH7.2) (1:30): 0.03 mg/ml; DMSO: 10 mg/ml; Ethanol: 2 mg/ml |
| form | White solid. |
| pka | 11.22±0.70(Predicted) |
| color | White to off-white |
| BRN | 1096975 |
| InChIKey | LAJXCUNOQSHRJO-ZYGJITOWSA-N |
| SMILES | C[C@H]1C\C=C\[C@H]2[C@@H]3O[C@]3(C)[C@@H](C)[C@H]4[C@H](Cc5ccccc5)NC(=O)[C@@]24OC(=O)O\C=C\[C@@](C)(O)C1=O |
| LogP | 1.920 (est) |
Safety Data
| Hazard Codes | T+,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1544 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | HA5360000 |
| F | 10 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29349990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral Repr. 2 |
| Hazardous Substances Data | 36011-19-5(Hazardous Substances Data) |