356-12-7
| Name | Fluocinonide |
| CAS | 356-12-7 |
| EINECS(EC#) | 206-597-6 |
| Molecular Formula | C26H32F2O7 |
| MDL Number | MFCD00079302 |
| Molecular Weight | 494.52 |
| MOL File | 356-12-7.mol |
Chemical Properties
| Melting point | 309 °C |
| alpha | D +83° (chloroform) |
| Boiling point | 235°C (rough estimate) |
| density | 1.2001 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO: ≥19mg/mL |
| form | powder |
| pka | 12.77±0.70(Predicted) |
| color | white to tan |
| Optical Rotation | [α]/D +75 to +90°, c = 1 in dichloromethane |
| Water Solubility | 0.53mg/L(25 ºC) |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | WJOHZNCJWYWUJD-IUGZLZTKSA-N |
| SMILES | [C@@]12(C(=O)COC(=O)C)OC(C)(C)O[C@@H]1C[C@@]1([H])[C@]3([H])C[C@@H](C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]21C)F |&1:0,13,15,17,20,27,29,31,34,r| |
Safety Data
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300-H361 |
| Precautionary statements | P201-P301+P310+P330 |
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | TU3831000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 2937220000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Repr. 2 |
| Toxicity |