315-72-0
| Name | OPIPRAMOL |
| CAS | 315-72-0 |
| EINECS(EC#) | 206-254-0 |
| Molecular Formula | C23H29N3O |
| MDL Number | MFCD00865455 |
| Molecular Weight | 363.5 |
| MOL File | 315-72-0.mol |
Chemical Properties
| Appearance | Crystalline Solid |
| Melting point | 100-1010C |
| Boiling point | 494.88°C (rough estimate) |
| density | 1.0920 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Acetonitrile: slightly soluble; Chloroform: slightly soluble; Methanol: slightly soluble |
| form | neat |
| pka | pKa 8(H2O,t =25,I=0.01(NaCl)) (Uncertain) |
| color | Light yellow to yellow |
| BRN | 627076 |
| Major Application | forensics and toxicology veterinary |
| InChI | 1S/C23H29N3O/c27-19-18-25-16-14-24(15-17-25)12-5-13-26-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)26/h1-4,6-11,27H,5,12-19H2 |
| InChIKey | YNZFUWZUGRBMHL-UHFFFAOYSA-N |
| SMILES | OCCN(CC1)CCN1CCCN2C(C=CC=C3)=C3C=CC4=C2C=CC=C4 |
Safety Data
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 1 |
| RTECS | TL8750000 |
| REACH Registrations | Active |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |