| Appearance |
dark brown crystalline powder |
| Melting point |
330 °C(lit.)
|
| density |
0.989 |
| storage temp. |
Store at RT. |
| solubility |
Solubility Soluble in water, ethanol |
| form |
Powder |
| pka |
8.1(at 25℃) |
| color |
Purple |
| Odor |
Phenolic odor |
| PH Range |
Red (7.1) to blue (9.1) |
| Stability: |
Stable. Incompatible with strong oxidizing agents. |
| Water Solubility |
Soluble in water. |
| λmax |
610nm |
| Merck |
14,1718 |
| BRN |
708596 |
| Major Application |
Nanoparticles, cleaning microelectronic substrates, sensors, photographic materials, recording materials, water hardness measurement, indicator for calcium and magnesium, determination of vanadium, medical component, measuring magnesium in biological fluids, diagnosis of diseases caused by elemental imbalance, treatment of thrombocytopenia, Kurine analysis test strip |
| InChI |
1S/C17H14N2O5S/c1-10-6-7-14(20)13(8-10)18-19-17-12-5-3-2-4-11(12)16(9-15(17)21)25(22,23)24/h2-9,20-21H,1H3,(H,22,23,24) |
| InChIKey |
VBRNLOQCBCPPHL-VHEBQXMUSA-N |
| SMILES |
Cc1ccc(O)c(c1)N=Nc2c(O)cc(c3ccccc23)S(O)(=O)=O |
| EPA Substance Registry System |
1-Naphthalenesulfonic acid, 3-hydroxy-4-[(2-hydroxy-5-methylphenyl)azo]- (3147-14-6) |
